For research use only. Not for therapeutic Use.
Pinobanksin(CAT: R044447) is a naturally occurring flavonoid found in propolis, honey, and various plants, particularly those in the Pinaceae family. Known for its potent antioxidant, anti-inflammatory, and antimicrobial properties, pinobanksin has garnered attention for its potential health benefits. It plays a role in neutralizing free radicals and protecting cells from oxidative stress, making it useful in the study of diseases linked to inflammation and oxidative damage, such as cardiovascular and neurodegenerative conditions. Additionally, its antibacterial properties contribute to its use in traditional medicine and research into natural therapies for infections and immune support.
CAS Number | 548-82-3 |
Synonyms | (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one; ?(2R-trans)-2,3-Dihydro-3,5,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one; 3,5,7-Trihydroxyflavanone; (2R,3R)-Pinobanksin; 3,5,7-Trihydroxyflavanone; Dihydrogalangin |
Molecular Formula | C15H12O5 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2R,3R)-3,5,7-trihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
InChIKey | SUYJZKRQHBQNCA-LSDHHAIUSA-N |
SMILES | C1=CC=C(C=C1)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |