For research use only. Not for therapeutic Use.
Pinocembrin chalcone(Cat No.:R004372)is a naturally occurring flavonoid compound known for its antioxidant, anti-inflammatory, and antimicrobial properties. Found in various plants, including Erythrina variegata, it plays a significant role in protecting cells from oxidative stress. This chalcone derivative has demonstrated potential in modulating pathways associated with cell signaling, offering therapeutic promise in conditions like cardiovascular diseases, neurodegenerative disorders, and cancer. Due to its bioactive effects, Pinocembrin chalcone is studied for its role in drug development, particularly in formulations aimed at reducing inflammation and improving overall health.
CAS Number | 4197-97-1 |
Molecular Formula | C15H12O4 |
Purity | ≥95% |
Target | Bacterial |
Storage | 4°C, away from moisture and light |
IUPAC Name | (E)-3-phenyl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
InChI | InChI=1S/C15H12O4/c16-11-8-13(18)15(14(19)9-11)12(17)7-6-10-4-2-1-3-5-10/h1-9,16,18-19H/b7-6+ |
InChIKey | LOYXTWZXLWHMBX-VOTSOKGWSA-N |
SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2O)O)O |