For research use only. Not for therapeutic Use.
(+)-Pinoresinol(CAT: R005572) is a natural lignan compound found in various plant sources, including fruits, vegetables, and medicinal herbs. Its mode of action involves being a polyphenolic compound with antioxidant and potential health-promoting properties. (+)-Pinoresinol has attracted interest in research due to its potential role in various health benefits, such as anti-inflammatory, anti-cancer, and cardiovascular protective effects. It has been studied for its potential in reducing oxidative stress and inflammation in the body. As a natural product, it is of interest in traditional medicine and herbal remedies, and further research is ongoing to explore its specific mechanisms and potential therapeutic applications
| CAS Number | 487-36-5 |
| Molecular Formula | C20H22O6 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
| InChI | InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | HGXBRUKMWQGOIE-AFHBHXEDSA-N |
| SMILES | COC1=C(C=CC(=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)O)OC)O |
