For research use only. Not for therapeutic Use.
Pinostrobin chalcone is found to be potent natural cytotoxic compounds against MDA-MB-231 and HT-29 colon cancer cell lines(IC50 = 20.42±2.23 and 22.51±0.42 μg/mL)[1].
| Catalog Number | R074650 |
| CAS Number | 18956-15-5 |
| Synonyms | (E)-1-(2,6-dihydroxy-4-methoxyphenyl)-3-phenylprop-2-en-1-one |
| Molecular Formula | C16H14O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H14O4/c1-20-12-9-14(18)16(15(19)10-12)13(17)8-7-11-5-3-2-4-6-11/h2-10,18-19H,1H3/b8-7+ |
| InChIKey | CUGDOWNTXKLQMD-BQYQJAHWSA-N |
| SMILES | COC1=CC(=C(C(=C1)O)C(=O)C=CC2=CC=CC=C2)O |
| Reference | [1]. Mohammed I ,et al. Isolation of cardamonin, pinostrobin chalcone from the rhizomes of Boesenbergia rotunda (L.) Mansf. and their cytotoxic effects on H-29 and MDA-MB-231 cancer cell lines[J]. The Natural Products Journal, 2019, 9(4):341-348. |
