For research use only, not for therapeutic use.
Pioglitazone（Cat No.:A000333）is an oral antidiabetic medication belonging to the thiazolidinedione class, primarily used in the management of type 2 diabetes mellitus. It functions as a selective agonist of peroxisome proliferator-activated receptor gamma (PPAR-γ), enhancing insulin sensitivity in muscle and adipose tissues. By improving glucose uptake and utilization, pioglitazone helps to lower blood sugar levels. Additionally, it has potential benefits for lipid profiles and cardiovascular health. Ongoing research explores its role in preventing diabetes-related complications and its therapeutic effects in other metabolic disorders, underscoring its clinical significance.
| Catalog Number | A000333 |
| CAS Number | 111025-46-8 |
| Synonyms | NA |
| Molecular Formula | C19H20N2O3S |
| Purity | ≥95% |
| Target | PPAR |
| Solubility | >14.3mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChI | InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23) |
| InChIKey | HYAFETHFCAUJAY-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C(C=C1)CCOC2=CC=C(C=C2)CC3C(=O)NC(=O)S3 |
