For research use only. Not for therapeutic Use.
Pipecuronium bromide(Cat No.:R041671), is a synthetic neuromuscular-blocking agent used in anesthesia to induce muscle relaxation during surgical procedures. It belongs to the class of non-depolarizing neuromuscular blockers, specifically aminosteroids, and acts by blocking the action of acetylcholine at the neuromuscular junction, leading to muscle paralysis. This pharmaceutical compound is employed to facilitate intubation and mechanical ventilation in surgical patients, improving surgical conditions and reducing muscle movements. Pipecuronium bromide has a longer duration of action than some other neuromuscular blockers, allowing for sustained muscle relaxation during surgery, making it a valuable tool in anesthesia practice.
Catalog Number | R041671 |
CAS Number | 52212-02-9 |
Synonyms | 4,4’-[(2β,3α,5α,16β,17β)-3,17-bis(acetyloxy)androstane-2,16-diyl]bis[1,1-dimethyl-piperazinium Bromide; Arduan; Pipecurium bromide; RGH 1106 |
Molecular Formula | C₃₅H₆₂Br₂N₄O₄ |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | Store at -20°C |
IUPAC Name | [(2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-17-acetyloxy-2,16-bis(4,4-dimethylpiperazin-4-ium-1-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;dibromide |
InChI | InChI=1S/C35H62N4O4.2BrH/c1-24(40)42-32-21-26-9-10-27-28(35(26,4)23-31(32)37-15-19-39(7,8)20-16-37)11-12-34(3)29(27)22-30(33(34)43-25(2)41)36-13-17-38(5,6)18-14-36;;/h26-33H,9-23H2,1-8H3;2*1H/q+2;;/p-2/t26-,27+,28-,29-,30-,31-,32-,33-,34-,35-;;/m0../s1 |
InChIKey | TXWBOBJCRVVBJF-YTGGZNJNSA-L |
SMILES | CC(=O)OC1CC2CCC3C(C2(CC1N4CC[N+](CC4)(C)C)C)CCC5(C3CC(C5OC(=O)C)N6CC[N+](CC6)(C)C)C.[Br-].[Br-] |