For research use only. Not for therapeutic Use.
Pipemidic acid（Cat No.:I003884）is a novel antibacterial agent with activity against a broad spectrum of bacteria, including Pseudomonas aeruginosa. It belongs to the class of drugs known as fluoroquinolones, which inhibit the bacterial DNA gyrase enzyme, leading to the disruption of DNA replication and cell division. This mechanism of action effectively targets and kills the bacteria. Pipemidic acid has shown promising efficacy in the treatment of various bacterial infections, particularly those caused by Pseudomonas aeruginosa, making it a valuable addition to the arsenal of antibacterial agents.
| Catalog Number | I003884 |
| CAS Number | 51940-44-4 |
| Molecular Formula | C14H17N5O3 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 8-ethyl-5-oxo-2-piperazin-1-ylpyrido[2,3-d]pyrimidine-6-carboxylic acid |
| InChI | InChI=1S/C14H17N5O3/c1-2-18-8-10(13(21)22)11(20)9-7-16-14(17-12(9)18)19-5-3-15-4-6-19/h7-8,15H,2-6H2,1H3,(H,21,22) |
| InChIKey | JOHZPMXAZQZXHR-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CN=C(N=C21)N3CCNCC3)C(=O)O |
| Reference | <p style=/line-height:25px/> |
