Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Chemical Reagents>Other Inhibitors> Piperidine-4-carbothioamide
For research use only. Not for therapeutic Use.
Piperidine-4-carbothioamide (CAT: L005580) is a synthetic compound with potential applications in organic synthesis and chemical research. Its mode of action may involve reactions with other molecules, possibly participating in various chemical transformations. While specific uses can vary, compounds like this are often investigated for their potential roles as building blocks or intermediates in the synthesis of more complex molecules.
Catalog Number | L005580 |
CAS Number | 112401-09-9 |
Molecular Formula | C6H12N2S |
Purity | ≥95% |
IUPAC Name | piperidine-4-carbothioamide |
InChI | InChI=1S/C6H12N2S/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2,(H2,7,9) |
InChIKey | LXOBYAWHAIZPPU-UHFFFAOYSA-N |