For research use only. Not for therapeutic Use.
Piperonyl acetone（Cat No.:I014573）is an organic compound derived from piperonal (3,4-methylenedioxybenzaldehyde) and acetone. It is primarily used in the fragrance and flavor industry due to its pleasant, sweet, and floral scent. Piperonyl acetone is also studied for its potential biological activities, including insecticidal properties, as it can act as a repellent for various pests. Additionally, research into its antioxidant and anti-inflammatory effects suggests possible therapeutic applications. Although widely used in perfumes and cosmetics, further studies are needed to explore its safety and effectiveness in medical or industrial applications.
| Catalog Number | I014573 |
| CAS Number | 55418-52-5 |
| Synonyms | Piperonyl acetone; NSC 405365; NSC-405365; NSC405365;4-(3,4-Methylenedioxyphenyl)-2-butaNA |
| Molecular Formula | C11H12O3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)butan-2-one |
| InChI | InChI=1S/C11H12O3/c1-8(12)2-3-9-4-5-10-11(6-9)14-7-13-10/h4-6H,2-3,7H2,1H3 |
| InChIKey | TZJLGGWGVLADDN-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=CC2=C(C=C1)OCO2 |
| Reference | </br> 1: Ensslin HK, Kovar KA, Maurer HH. Toxicological detection of the designer drug 3,4-methylenedioxyethylamphetamine (MDE, ‘Eve’) and its metabolites in urine by gas chromatography-mass spectrometry and fluorescence polarization immunoassay. J Chromatogr B Biomed Appl. 1996 Aug 30;683(2):189-97. PubMed PMID: 8891915.</br>2: Wright DJ, Holder GM. The metabolism of some food additives related to piperonal in the rabbit. Xenobiotica. 1980 Apr;10(4):265-70. PubMed PMID: 7415207.</br></br> |
