For research use only. Not for therapeutic Use.
Piperonyl methyl ketone(CAT: R064560) (also known as PMK or heliotropin) is an organic compound commonly used as a key intermediate in the synthesis of fragrances, flavorings, and pharmaceuticals. Structurally, it is derived from safrole and features a methylenedioxyphenyl group, giving it a characteristic scent often used in the perfume industry. Beyond its role in cosmetics, Piperonyl methyl ketone is also important in the synthesis of various chemicals and has applications in organic chemistry. Its reactivity as a ketone makes it useful in a wide range of chemical transformations, including drug development and research.
| Catalog Number | R064560 |
| CAS Number | 4676-39-5 |
| Synonyms | MDP2P;3,4-Methylenedioxyphenylpropan-2-one;NSC 16688;PMK;PVI-2 |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)propan-2-one |
| InChI | InChI=1S/C10H10O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5H,4,6H2,1H3 |
| InChIKey | XIYKRJLTYKUWAM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC2=C(C=C1)OCO2 |
