For research use only. Not for therapeutic Use.
Pirenoxine（Cat No.:M069353） is a pharmaceutical compound primarily utilized in ophthalmic solutions for treating various eye conditions, particularly cataracts and dry eyes. Its mode of action involves antioxidant and anti-inflammatory properties, which help in reducing oxidative stress and inflammation in the eye tissues. Pirenoxine is believed to inhibit the formation of cataracts by preventing protein denaturation and aggregation in the lens. Moreover, it aids in maintaining proper eye lubrication by enhancing tear film stability.
| Catalog Number | M069353 |
| CAS Number | 1043-21-6 |
| Molecular Formula | C16H8N2O5 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid |
| InChI | InChI=1S/C16H8N2O5/c19-9-5-8(16(21)22)18-14-10(20)6-12-15(13(9)14)17-7-3-1-2-4-11(7)23-12/h1-6H,(H,18,19)(H,21,22) |
| InChIKey | OKPNYGAWTYOBFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C(=CC(=O)C4=C3C(=O)C=C(N4)C(=O)O)O2 |
