For research use only. Not for therapeutic Use.
Pirenperone（Cat No.:I034813）is a selective serotonin 5-HT1A receptor antagonist, commonly studied for its potential in treating psychiatric disorders. It works by blocking the 5-HT1A receptors, which are involved in regulating mood, anxiety, and cognition. Pirenperone has been investigated for its anxiolytic and antidepressant effects, as well as its role in modulating serotonin activity in the brain. Though primarily researched for its neuropharmacological properties, it has also been studied for its potential to affect dopamine pathways, making it of interest for disorders like schizophrenia and other mood-related conditions.
| CAS Number | 75444-65-4 |
| Synonyms | 3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one |
| Molecular Formula | C23H24FN3O2 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one |
| InChI | InChI=1S/C23H24FN3O2/c1-16-20(23(29)27-12-3-2-4-21(27)25-16)11-15-26-13-9-18(10-14-26)22(28)17-5-7-19(24)8-6-17/h2-8,12,18H,9-11,13-15H2,1H3 |
| InChIKey | HXCNRYXBZNHDNE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(CC3)C(=O)C4=CC=C(C=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
