For research use only. Not for therapeutic Use.
Piromelatine is a multimodal sleep-regulating agent that acts as an agonist of melatonin receptors (MT1 and MT2) and serotonin receptors (5-HT1A and 5-HT1D). It is primarily studied for its potential to treat insomnia and other sleep disorders, as well as neurodegenerative conditions such as Alzheimer’s disease. By influencing both melatonin and serotonin pathways, piromelatine promotes sleep onset and maintenance while also modulating mood and circadian rhythms. Its neuroprotective and cognitive-enhancing effects are being explored for broader applications, including anxiety and depression, making it a promising candidate for sleep and neurological therapies.
| Catalog Number | I008416 |
| CAS Number | 946846-83-9 |
| Synonyms | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-4-oxopyran-2-carboxamide |
| Molecular Formula | C17H16N2O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H16N2O4/c1-22-13-2-3-15-14(9-13)11(10-19-15)4-6-18-17(21)16-8-12(20)5-7-23-16/h2-3,5,7-10,19H,4,6H2,1H3,(H,18,21) |
| InChIKey | PNTNBIHOAPJYDB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2CCNC(=O)C3=CC(=O)C=CO3 |
