For research use only. Not for therapeutic Use.
PIT (Cat No.:I010448) is a compound designed to inhibit the activity of phosphatidylinositol 3-kinase (PI3K), a key enzyme involved in cell growth, survival, and metabolism. By targeting PI3K, PIT disrupts downstream signaling pathways that regulate tumor growth and cell proliferation. This makes PIT a potential therapeutic agent in cancer treatment, particularly in tumors with aberrant PI3K activity. Additionally, PIT may have applications in other diseases where PI3K signaling is dysregulated, including metabolic disorders and certain autoimmune diseases, though further research is needed.
| CAS Number | 56583-49-4 |
| Synonyms | 4-methylbenzenesulfonic acid;1-oxido-2-pyridin-2-ylindol-1-ium-3-one |
| Molecular Formula | C20H16N2O5S |
| Purity | ≥95% |
| IUPAC Name | 4-methylbenzenesulfonic acid;1-oxido-2-pyridin-2-ylindol-1-ium-3-one |
| InChI | InChI=1S/C13H8N2O2.C7H8O3S/c16-13-9-5-1-2-7-11(9)15(17)12(13)10-6-3-4-8-14-10;1-6-2-4-7(5-3-6)11(8,9)10/h1-8H;2-5H,1H3,(H,8,9,10) |
| InChIKey | MMPTYEXNPWSTOR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C2C(=C1)C(=O)C(=[N+]2[O-])C3=CC=CC=N3 |
