For research use only. Not for therapeutic Use.
Pivalic acid-d9 is a deuterated form of pivalic acid, featuring nine deuterium atoms that enhance its stability and accuracy in analytical applications. This compound is used extensively in pharmaceutical and chemical research to study reaction mechanisms and metabolic pathways using techniques such as NMR and mass spectrometry. In organic chemistry, Pivalic acid-d9 serves as a labeled reagent or solvent, facilitating the synthesis and analysis of other compounds. Its deuterium labeling helps track the behavior of pivalic acid in various chemical environments and contributes to research in material science and environmental chemistry.
CAS Number | 42983-07-3 |
Synonyms | 2,2-Di(methyl-d3)propanoic-3,3,3-d3 Acid; 2,2-Dimethylpropanoic Acid-d9; 2,2,2-Trimethylacetic Acid-d9; 2,2-Dimethylpropanoic Acid-d9; 2,2-Dimethylpropionic Acid-d9; NSC 65449-d9; Neopentanoic Acid-d9; Neovaleric Acid-d9; Trimethylacetic Acid-d9; Tri |
Molecular Formula | C5H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanoic acid |
InChI | InChI=1S/C5H10O2/c1-5(2,3)4(6)7/h1-3H3,(H,6,7)/i1D3,2D3,3D3 |
InChIKey | IUGYQRQAERSCNH-GQALSZNTSA-N |
SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |