For research use only. Not for therapeutic Use.
PK095(Cat No.:I041071)is a potent and selective small molecule inhibitor of the protein-protein interaction between PHD finger protein 3 (PHF3) and histone deacetylases (HDACs). By disrupting this interaction, PK095 modulates the epigenetic regulation of gene expression and has shown promise in targeting cancer cells, particularly in solid tumors. Preclinical studies suggest that PK095 can inhibit tumor growth and induce cell cycle arrest, making it a potential candidate for cancer therapies. Additionally, PK095 may have applications in neurological diseases and other conditions associated with aberrant epigenetic regulation.
CAS Number | 380314-37-4 |
Synonyms | N-(9-ethylcarbazol-3-yl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
Molecular Formula | C20H18N4O2S |
Purity | ≥95% |
IUPAC Name | N-(9-ethylcarbazol-3-yl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
InChI | InChI=1S/C20H18N4O2S/c1-2-24-16-6-4-3-5-14(16)15-11-13(7-8-17(15)24)22-19(26)12-27-20-21-10-9-18(25)23-20/h3-11H,2,12H2,1H3,(H,22,26)(H,21,23,25) |
InChIKey | ALEUTTNIZDFZSP-UHFFFAOYSA-N |
SMILES | CCN1C2=C(C=C(C=C2)NC(=O)CSC3=NC=CC(=O)N3)C4=CC=CC=C41 |