For research use only. Not for therapeutic Use.
PK095 is a p53 mutant stabilizer. PK095 can be used for research of cancer[1].
| Catalog Number | I041071 |
| CAS Number | 380314-37-4 |
| Synonyms | N-(9-ethylcarbazol-3-yl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| Molecular Formula | C20H18N4O2S |
| Purity | ≥95% |
| InChI | InChI=1S/C20H18N4O2S/c1-2-24-16-6-4-3-5-14(16)15-11-13(7-8-17(15)24)22-19(26)12-27-20-21-10-9-18(25)23-20/h3-11H,2,12H2,1H3,(H,22,26)(H,21,23,25) |
| InChIKey | ALEUTTNIZDFZSP-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)NC(=O)CSC3=NC=CC(=O)N3)C4=CC=CC=C41 |
| Reference | [1]. Alan Fersht, et al. Compounds for use in stabilizing p53 mutants. Patent. WO2009136175. |
