For research use only. Not for therapeutic Use.
PKM2 activator 5(Cat No.:I042629)is a small molecule designed to selectively activate pyruvate kinase M2 (PKM2), an enzyme that plays a critical role in the regulation of glycolysis, energy production, and cellular metabolism. PKM2 is often dysregulated in cancer cells, where it contributes to the Warburg effect, allowing tumor cells to maintain high rates of glycolysis even in the presence of oxygen. By activating PKM2, PKM2 activator 5 aims to restore normal metabolic functions and inhibit cancer cell proliferation. It is being explored as a potential therapeutic agent for cancer treatment, particularly in metabolic reprogramming strategies.
CAS Number | 796092-26-7 |
Synonyms | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-(3-fluorophenyl)sulfonylpiperazine |
Molecular Formula | C18H19FN2O6S2 |
Purity | ≥95% |
IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-(3-fluorophenyl)sulfonylpiperazine |
InChI | InChI=1S/C18H19FN2O6S2/c19-14-2-1-3-15(12-14)28(22,23)20-6-8-21(9-7-20)29(24,25)16-4-5-17-18(13-16)27-11-10-26-17/h1-5,12-13H,6-11H2 |
InChIKey | SOEFEUAERZUSNF-UHFFFAOYSA-N |
SMILES | C1CN(CCN1S(=O)(=O)C2=CC3=C(C=C2)OCCO3)S(=O)(=O)C4=CC=CC(=C4)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |