For research use only. Not for therapeutic Use.
PLK4-IN-4 (Cat No.: I040129) is a small-molecule inhibitor targeting polo-like kinase 4 (PLK4), a critical regulator of centriole biogenesis and cell division. By inhibiting PLK4, PLK4-IN-4 disrupts centrosome function, leading to defective cell division and mitotic errors. This makes it a promising candidate for cancer therapy, particularly in cancers characterized by abnormal cell division and centrosome amplification. Preclinical studies suggest that PLK4-IN-4 could suppress tumor growth and improve the effectiveness of other anticancer treatments by selectively targeting proliferating cancer cells.
| CAS Number | 2923999-01-1 |
| Synonyms | 6-N-[(2,4-difluorophenyl)methyl]-4-N-(5-methyl-1H-pyrazol-3-yl)-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| Molecular Formula | C21H23F2N9 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H23F2N9/c1-12-8-18(31-30-12)27-19-16-11-26-32(15-4-6-24-7-5-15)20(16)29-21(28-19)25-10-13-2-3-14(22)9-17(13)23/h2-3,8-9,11,15,24H,4-7,10H2,1H3,(H3,25,27,28,29,30,31) |
| InChIKey | HPYJNDCKRXOAKV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=C3C=NN(C3=NC(=N2)NCC4=C(C=C(C=C4)F)F)C5CCNCC5 |
| Reference | [1]. DongMei Zhao, et al. Pyrazolopyrimidine derivative, and preparation method and application thereof. CN116023380A. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
