For research use only. Not for therapeutic Use.
PLN-1474（Cat No.:I042562）is a selective, small molecule inhibitor designed to target and inhibit the protein liver receptor homolog-1 (LRH-1), a nuclear receptor involved in regulating various processes such as cholesterol metabolism, bile acid synthesis, and inflammation. By modulating LRH-1 activity, PLN-1474 has potential therapeutic applications in metabolic diseases, particularly those related to lipid and cholesterol dysregulation, such as non-alcoholic fatty liver disease (NAFLD) and atherosclerosis. Ongoing research is focused on evaluating the efficacy of PLN-1474 in preclinical and clinical studies, with the aim of offering new treatment options for metabolic disorders.
| CAS Number | 2408065-32-5 |
| Synonyms | (2S)-2-[(4-methyloxane-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| Molecular Formula | C24H37N3O4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[(4-methyloxane-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| InChI | InChI=1S/C24H37N3O4/c1-24(13-16-31-17-14-24)23(30)27-20(22(28)29)10-6-4-2-3-5-9-19-12-11-18-8-7-15-25-21(18)26-19/h11-12,20H,2-10,13-17H2,1H3,(H,25,26)(H,27,30)(H,28,29)/t20-/m0/s1 |
| InChIKey | GELVLHVQVRSFAY-FQEVSTJZSA-N |
| SMILES | CC1(CCOCC1)C(=O)N[C@@H](CCCCCCCC2=NC3=C(CCCN3)C=C2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
