For research use only. Not for therapeutic Use.
Plogosertib(Cat No.:I043392)is a small-molecule inhibitor that targets the protein kinase DNA-PK (DNA-dependent protein kinase), which plays a critical role in DNA repair, particularly in the repair of double-strand breaks. By inhibiting DNA-PK, plogosertib disrupts the repair mechanisms of cancer cells, making them more susceptible to DNA damage and potentially enhancing the efficacy of other cancer treatments, such as radiation and chemotherapy. This targeted approach has shown promise in preclinical studies for treating various cancers, including solid tumors, by sensitizing them to DNA-damaging therapies and potentially overcoming resistance mechanisms.
CAS Number | 1137212-79-3 |
Synonyms | 4-[(9-cyclopentyl-5-methyl-6-oxospiro[8H-pyrimido[4,5-b][1,4]diazepine-7,1′-cyclopropane]-2-yl)amino]-3-methoxy-N-[4-(4-methylpiperazin-1-yl)cyclohexyl]benzamide |
Molecular Formula | C34H48N8O3 |
Purity | ≥95% |
IUPAC Name | 4-[(9-cyclopentyl-5-methyl-6-oxospiro[8H-pyrimido[4,5-b][1,4]diazepine-7,1'-cyclopropane]-2-yl)amino]-3-methoxy-N-[4-(4-methylpiperazin-1-yl)cyclohexyl]benzamide |
InChI | InChI=1S/C34H48N8O3/c1-39-16-18-41(19-17-39)25-11-9-24(10-12-25)36-31(43)23-8-13-27(29(20-23)45-3)37-33-35-21-28-30(38-33)42(26-6-4-5-7-26)22-34(14-15-34)32(44)40(28)2/h8,13,20-21,24-26H,4-7,9-12,14-19,22H2,1-3H3,(H,36,43)(H,35,37,38) |
InChIKey | UFNLNMWVOMFWGS-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)C2CCC(CC2)NC(=O)C3=CC(=C(C=C3)NC4=NC=C5C(=N4)N(CC6(CC6)C(=O)N5C)C7CCCC7)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |