For research use only. Not for therapeutic Use.
PLpro Inhibitor(Cat No.:I000390)is a potent inhibitor targeting the papain-like protease (PLpro) enzyme, crucial for viral replication in various RNA viruses, including SARS-CoV-2. By blocking PLpro activity, it prevents the virus from processing its polyprotein precursors, hindering its replication cycle. PLpro inhibitors are being explored as therapeutic agents for treating viral infections, particularly in the context of COVID-19. Their specificity in inhibiting the viral enzyme without affecting host proteases makes them promising candidates for antiviral drug development, aiming to mitigate viral load and disease progression.
CAS Number | 1093070-14-4 |
Synonyms | (Z)-5-((Z)-(1-hydroxyethylidene)amino)-2-methyl-N-((R)-1-(naphthalen-1-yl)ethyl)benzimidic acid |
Molecular Formula | C22H22N2O2 |
Purity | ≥95% |
Target | SARS-CoV |
Solubility | DMSO: ≥ 42 mg/mL |
Storage | Sealed in dry,Room Temperature |
IC50 | 2.6 uM |
IUPAC Name | 5-acetamido-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
InChI | InChI=1S/C22H22N2O2/c1-14-11-12-18(24-16(3)25)13-21(14)22(26)23-15(2)19-10-6-8-17-7-4-5-9-20(17)19/h4-13,15H,1-3H3,(H,23,26)(H,24,25)/t15-/m1/s1 |
InChIKey | KGPYBLOBHQLIET-OAHLLOKOSA-N |
SMILES | CC1=C(C=C(C=C1)NC(=O)C)C(=O)N[C@H](C)C2=CC=CC3=CC=CC=C32 |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |