PMK ethyl glycidate is used to prepare methylenedioxy phenethylamines and amphetamines. Also, it’s a reference standard. This product is used for new drug development and other scientific research purposes.
| Catalog Number | R067081 |
| CAS Number | 28578-16-7 |
| Synonyms | NSC 195099 |
| Molecular Formula | C13H14O5 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | ethyl 3-(1,3-benzodioxol-5-yl)-2-methyloxirane-2-carboxylate |
| InChI | InChI=1S/C13H14O5/c1-3-15-12(14)13(2)11(18-13)8-4-5-9-10(6-8)17-7-16-9/h4-6,11H,3,7H2,1-2H3 |
| InChIKey | BRILFEZHPXQINW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(O1)C2=CC3=C(C=C2)OCO3)C |
