PMK methyl glycidate(CAT: R067028) is a starting material for the synthesis of 3,4-methylenedioxymethamphetamine (MDMA) and other psychotropic drugs. This product is used for organic synthesis, pharmaceutical research and development, and other scientific purposes.
| Catalog Number | R067028 |
| CAS Number | 13605-48-6 |
| Synonyms | 3-(1,3-benzodioxol-5-yl)-2-methyl-2-oxiranecarboxylic acid, methyl ester |
| Molecular Formula | C12H12O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl 3-(1,3-benzodioxol-5-yl)-2-methyloxirane-2-carboxylate |
| InChI | InChI=1S/C12H12O5/c1-12(11(13)14-2)10(17-12)7-3-4-8-9(5-7)16-6-15-8/h3-5,10H,6H2,1-2H3 |
| InChIKey | NEWFBAYQRLTJTP-UHFFFAOYSA-N |
| SMILES | CC1(C(O1)C2=CC3=C(C=C2)OCO3)C(=O)OC |
