For research use only. Not for therapeutic Use.
pNNP (Cat.No:I012292), also known as para-nitrophenyl phosphate, is a chemical compound commonly used as a substrate for the detection and quantification of phosphatase enzyme activity. It is cleaved by phosphatases, resulting in the release of para-nitrophenol, which can be measured spectrophotometrically. pNNP is extensively employed in various biochemical assays and research applications.
CAS Number | 330-13-2 |
Synonyms | p-Nitrophenyl phosphate; 4-nitrophenyl phosphate; 4-Nitrophenyl dihydrogen phosphate |
Molecular Formula | C6H6NO6P |
Purity | ≥95% |
InChI | InChI=1S/C6H6NO6P/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H2,10,11,12) |
InChIKey | XZKIHKMTEMTJQX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)O |