For research use only. Not for therapeutic Use.
PNU-177864（Cat No.:I010751）is a selective small molecule inhibitor of the protein kinase A (PKA) pathway, specifically targeting the cAMP-dependent protein kinase. By inhibiting PKA, PNU-177864 can modulate various cellular processes such as cell growth, differentiation, and metabolism, which are regulated by PKA signaling. It is being studied in the context of cancer research, particularly for its potential to disrupt cancer cell proliferation and survival. Additionally, PNU-177864 may have applications in other diseases where PKA plays a critical role, including cardiovascular and metabolic disorders, and is being evaluated for therapeutic potential.
| CAS Number | 250266-51-4 |
| Synonyms | N-[4-[2-(propylamino)ethyl]phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| Molecular Formula | C18H21F3N2O3S |
| Purity | ≥95% |
| IUPAC Name | N-[4-[2-(propylamino)ethyl]phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| InChI | InChI=1S/C18H21F3N2O3S/c1-2-12-22-13-11-14-3-5-15(6-4-14)23-27(24,25)17-9-7-16(8-10-17)26-18(19,20)21/h3-10,22-23H,2,11-13H2,1H3 |
| InChIKey | JGGQWSXZZQPZTR-UHFFFAOYSA-N |
| SMILES | CCCNCCC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)OC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
