For research use only. Not for therapeutic Use.
PNU-74654 is a potent and selective inhibitor of the protein kinase CK2, a serine/threonine kinase involved in various cellular processes, including cell proliferation, survival, and apoptosis. By inhibiting CK2, PNU-74654 has shown potential in modulating signaling pathways linked to cancer progression and other diseases. It offers promise for therapeutic applications, particularly in targeting cancers with overactive CK2 signaling. This compound serves as a valuable tool for research in cancer therapeutics and kinase-targeted therapies.
| Catalog Number | I013744 |
| CAS Number | 113906-27-7 |
| Molecular Formula | C₁₉H₁₆N₂O₃ |
| Purity | ≥95% |
| Target | Wntβ-catenin |
| Solubility | DMSO: ≥ 30 mg/mL |
| IUPAC Name | N-[(E)-(5-methylfuran-2-yl)methylideneamino]-2-phenoxybenzamide |
| InChI | InChI=1S/C19H16N2O3/c1-14-11-12-16(23-14)13-20-21-19(22)17-9-5-6-10-18(17)24-15-7-3-2-4-8-15/h2-13H,1H3,(H,21,22)/b20-13+ |
| InChIKey | JJEDWBQZCRESJL-DEDYPNTBSA-N |
| SMILES | CC1=CC=C(O1)C=NNC(=O)C2=CC=CC=C2OC3=CC=CC=C3 |
