POBN (α-(4-Pyridyl-1-oxide)-N-tert-butylnitrone) is a spin-trapping agent commonly used in biochemical research to detect and characterize free radicals. Its ability to form stable adducts with reactive oxygen species makes it a valuable tool in studying oxidative stress and related processes in biological systems. POBN is particularly useful in electron paramagnetic resonance (EPR) spectroscopy, where it helps identify and quantify transient radical species. Its applications include research on aging, disease mechanisms, and the development of antioxidant therapies.
| Catalog Number | R066808 |
| CAS Number | 66893-81-0 |
| Synonyms | 4-POBN |
| Molecular Formula | C10H14N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | tert-butyl-[(1-oxidopyridin-4-ylidene)methyl]-oxoazanium |
| InChI | InChI=1S/C10H14N2O2/c1-10(2,3)12(14)8-9-4-6-11(13)7-5-9/h4-8H,1-3H3 |
| InChIKey | RNRMWTCECDHNQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[N+](=O)C=C1C=CN(C=C1)[O-] |
