For research use only. Not for therapeutic Use.
POE (polyoxyethylene) propylene glycol monostearate is a nonionic surfactant used in various industries, including food, pharmaceuticals, and cosmetics. This compound acts as an emulsifier, stabilizer, and solubilizer in formulations. Its polyoxyethylene chain enhances water solubility and improves dispersibility of hydrophobic substances. POE propylene glycol monostearate contributes to the stability and texture of products such as creams, lotions, and food emulsions.
| Catalog Number | R071330 |
| CAS Number | 37231-60-0 |
| Synonyms | Atlas G-2162 |
| Molecular Formula | C23H45O4- |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-methyloxirane;octadecanoate;oxirane |
| InChI | InChI=1S/C18H36O2.C3H6O.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-2-4-3;1-2-3-1/h2-17H2,1H3,(H,19,20);3H,2H2,1H3;1-2H2/p-1 |
| InChIKey | ZKXANOHRNLAJJO-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CC1CO1.C1CO1 |
