For research use only. Not for therapeutic Use.
POL1-IN-1 is a RNA polymerase 1 (POL1, also known as Pol I) inhibitor with an IC50 of less than 0.5 uM. POL1-IN-1 inhibits ribosome biogenesis by inhibiting POL1 transcription[1].
| Catalog Number | I015062 |
| CAS Number | 1822358-25-7 |
| Synonyms | 2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]benzimidazolo[1,2-a][1,8]naphthyridine-6-carbonitrile |
| Molecular Formula | C21H20N6 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H20N6/c1-13-11-26(12-14(2)23-13)19-8-7-15-9-16(10-22)21-24-17-5-3-4-6-18(17)27(21)20(15)25-19/h3-9,13-14,23H,11-12H2,1-2H3/t13-,14+ |
| InChIKey | HFQPEPQECNSOFF-OKILXGFUSA-N |
| SMILES | CC1CN(CC(N1)C)C2=NC3=C(C=C2)C=C(C4=NC5=CC=CC=C5N34)C#N |
| Reference | [1]. Mustapha Haddach. Compositions, uses and methods for making them. US9758518B2. |
