For research use only. Not for therapeutic Use.
POLA1 Inhibitor 1（Cat No.:I043505）is a selective small-molecule inhibitor targeting POLA1 (DNA polymerase alpha-primase complex), a critical enzyme involved in DNA replication and repair. By inhibiting POLA1, this compound disrupts the replication of cancer cells, particularly in tumors with high rates of DNA replication and repair. POLA1 Inhibitor 1 has shown promise in preclinical studies as a potential therapeutic strategy for treating various cancers, including those with altered DNA repair mechanisms, by sensitizing cancer cells to DNA-damaging treatments like chemotherapy and radiation, thereby improving treatment efficacy.
| CAS Number | 2217671-41-3 |
| Synonyms | (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-[(E)-hydroxyiminomethyl]phenyl]prop-2-enoic acid |
| Molecular Formula | C26H27NO4 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-[(E)-hydroxyiminomethyl]phenyl]prop-2-enoic acid |
| InChI | InChI=1S/C26H27NO4/c28-24-5-3-20(22-4-1-16(2-6-25(29)30)10-21(22)15-27-31)11-23(24)26-12-17-7-18(13-26)9-19(8-17)14-26/h1-6,10-11,15,17-19,28,31H,7-9,12-14H2,(H,29,30)/b6-2+,27-15+ |
| InChIKey | PLQNJDDLZLIMNK-DTHWQZMASA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)C5=C(C=C(C=C5)/C=C/C(=O)O)/C=N/O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
