For research use only. Not for therapeutic Use.
Poly(phenylmethyl)silane(Cat No.:M098516) is a polysilane compound characterized by its backbone of silicon atoms, each bonded to phenylmethyl groups. This structure imparts unique properties such as UV resistance, thermal stability, and interesting electronic characteristics, making it relevant in materials science. Such polymers are often explored for their potential applications in photovoltaic devices, as coatings that can withstand harsh environmental conditions, and in the electronics industry for components requiring robust insulating properties. The phenyl groups contribute to the polymer’s rigidity and stability, enhancing its utility in various high-performance materials.
CAS Number | 146088-00-8 |
Synonyms | Silane, methylphenyl-, homopolymer (9CI); Methylphenylsilane homopolymer; Poly(methylphenylsilane) |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [[(2R,3S,5R)-5-(6-amino-2-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
InChI | InChI=1S/C10H16N5O13P3/c11-8-7-9(14-10(17)13-8)15(3-12-7)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
InChIKey | UOACBPRDWRDEHJ-KVQBGUIXSA-N |
SMILES | C1C(C(OC1N2C=NC3=C(NC(=O)N=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |