For research use only. Not for therapeutic Use.
Polyacrylic acid (Cat.No:R070891) is a synthetic polymer widely used in various industries. Its water-absorbing and adhesive properties make it valuable in hygiene products, superabsorbent materials, and adhesives. Polyacrylic acid is also utilized in water treatment, textiles, and personal care products due to its ability to modify viscosity and enhance performance.
| Catalog Number | R070891 |
| CAS Number | 9003-01-4 |
| Molecular Formula | C3H4O2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | prop-2-enoic acid |
| InChI | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| InChIKey | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O |
| Documentation | CoA |
