For research use only. Not for therapeutic Use.
Polyethylene-graft-maleic anhydride (PE-g-MAH) is a functionalized polymer known for its enhanced adhesion and compatibility properties. It is widely used in applications requiring strong bonding between dissimilar materials, such as in composite materials, coatings, and adhesives. PE-g-MAH improves the mechanical and thermal properties of polymer blends, making it essential in automotive, packaging, and construction industries. Its high reactivity and versatility ensure reliable performance and enhanced product durability, making it a critical component in advanced material engineering and manufacturing.
Catalog Number | M008918 |
CAS Number | 106343-08-2 |
Molecular Formula | C20H30N8O9 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-[[2-[[(2S)-2-[[2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]pentanedioic acid |
InChI | InChI=1S/C20H30N8O9/c21-11(1-3-14(22)29)18(34)24-7-16(31)28-13(5-10-6-23-9-26-10)19(35)25-8-15(30)27-12(20(36)37)2-4-17(32)33/h6,9,11-13H,1-5,7-8,21H2,(H2,22,29)(H,23,26)(H,24,34)(H,25,35)(H,27,30)(H,28,31)(H,32,33)(H,36,37)/t11-,12-,13-/m0/s1 |
InChIKey | ZDCKGJOKZZOVFP-AVGNSLFASA-N |
SMILES | C1=C(NC=N1)CC(C(=O)NCC(=O)NC(CCC(=O)O)C(=O)O)NC(=O)CNC(=O)C(CCC(=O)N)N |