Polyglyceryl-10 Oleate is an emulsifying agent commonly used in cosmetics, personal care, and food products. It is derived from oleic acid (a fatty acid found in oils like olive oil) and polyglycerol, making it a non-ionic surfactant. Polyglyceryl-10 Oleate helps blend water and oil phases in formulations, providing a smooth, stable texture in creams, lotions, and emulsions. It is favored for its mild, skin-friendly properties and is often included in natural and eco-friendly product lines due to its biodegradable and plant-based origins. Additionally, it offers moisturizing and skin-conditioning benefits in skincare products.
| Catalog Number | M144263 |
| CAS Number | 9007-48-1 |
| Synonyms | Polyglycerol-4-oleate |
| Molecular Formula | C23H25ClF3N5O |
| Purity | ≥95% |
| Storage | RT |
| InChI | 1S/C36H70O14/c37-19-27(43)14-12-10-8-6-4-2-1-3-5-7-9-11-13-26(15-28(44)20-38)33(16-29(45)21-39)34(17-30(46)22-40)35(18-31(47)23-41)36(49)50-25-32(48)24-42/h5,7,26-35,37-48H,1-4,6,8-25H2/b7-5+ |
| InChIKey | RAIRMBHOCCUQAG-FNORWQNLSA-N |
| SMILES | C(CCCC/C=C/CCCC(CC(CO)O)C(CC(CO)O)C(CC(CO)O)C(CC(CO)O)C(=O)OCC(CO)O)CCCCC(CO)O |
