For research use only. Not for therapeutic Use.
Polyisobutylene with high viscosity is a polymer characterized by its thick and viscous nature. With its unique rheological properties, high viscosity polyisobutylene finds applications in various industries. Common uses include serving as a thickening agent in lubricants and greases, enhancing the viscosity of adhesives and sealants, and improving the elasticity of elastomeric materials. Its ability to form durable, flexible seals and coatings makes it valuable in construction, automotive, and manufacturing sectors. Additionally, it finds utility in pharmaceuticals and cosmetics for its film-forming and moisturizing properties.
| Catalog Number | R069930 |
| CAS Number | 9003-27-4 |
| Molecular Formula | C4H8 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-methylprop-1-ene |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| InChIKey | VQTUBCCKSQIDNK-UHFFFAOYSA-N |
| SMILES | CC(=C)C |
