For research use only. Not for therapeutic Use.
Polyquaternium-51(Cat No.:M017872), is a synthetic polymer commonly used in the cosmetic and personal care industry. It belongs to the polyquaternium family, which consists of quaternary ammonium compounds. Polyquaternium-51 is known for its hydrating and moisturizing properties when used in skincare and haircare products. It helps improve the moisture retention capacity of the skin and hair, promoting hydration and preventing dryness. Additionally, it is often included in cosmetics and hair care formulations to enhance the overall appearance and texture, providing a smoother and more conditioned feel. Its versatility makes it a valuable ingredient in various beauty products.
CAS Number | 125275-25-4 |
Molecular Formula | C19H36NO8P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | butyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate |
InChI | InChI=1S/C11H22NO6P.C8H14O2/c1-10(2)11(13)16-8-9-18-19(14,15)17-7-6-12(3,4)5;1-4-5-6-10-8(9)7(2)3/h1,6-9H2,2-5H3;2,4-6H2,1,3H3 |
InChIKey | YMBGNWVYKDMNSN-UHFFFAOYSA-N |
SMILES | CCCCOC(=O)C(=C)C.CC(=C)C(=O)OCCOP(=O)([O-])OCC[N+](C)(C)C |