For research use only. Not for therapeutic Use.
Pomalidomide-d3（Cat No.:S000279） is a deuterated variant of pomalidomide, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification is particularly valuable as an internal standard for analytical techniques like mass spectrometry and NMR spectroscopy. Pomalidomide is an immunomodulatory drug used primarily for treating multiple myeloma, especially in patients who have shown resistance to other treatments. The use of deuterium in pomalidomide-d3 allows for more precise pharmacokinetic and metabolic studies, facilitating a deeper understanding of the drug’s absorption, distribution, metabolism, and excretion in the human body.
| Catalog Number | S000279 |
| CAS Number | 2093128-28-8 |
| Molecular Formula | C13H8D3N3O4 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-5,6,7-trideuterio-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChI | InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18)/i1D,2D,3D |
| InChIKey | UVSMNLNDYGZFPF-CBYSEHNBSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)N |
