For research use only. Not for therapeutic Use.
Pomalidomide-d4(Cat No.:R029563) is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. Featuring four deuterium atoms, this isotopically labeled version of pomalidomide is crucial for studying anti-cancer mechanisms, drug metabolism, and pharmacokinetics. It enhances the precision and accuracy of analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for drug development, oncology research, and metabolic studies, Pomalidomide-d4 integrates seamlessly into existing research protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 1416575-78-4 |
Synonyms | 4-Amino-2-(2,6-dioxo-3-piperidinyl)isoindole-1,3-dione-d4; 4-Amino-2-(2,6-dioxo-3-piperidyl)isoindoline-1,3-dione-d4; Actimid-d4; CC 4047-d4; IMiD 3-d4 |
Molecular Formula | C₁₃H₇D₄N₃O₄ |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 4-amino-2-(4,4,5,5-tetradeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
InChI | InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18)/i4D2,5D2 |
InChIKey | UVSMNLNDYGZFPF-CQOLUAMGSA-N |
SMILES | [2H]C1(C(C(=O)NC(=O)C1([2H])[2H])N2C(=O)C3=C(C2=O)C(=CC=C3)N)[2H] |