For research use only. Not for therapeutic Use.
Pomolic acid (Cat.No:M059890) is a naturally occurring triterpenoid compound found in various plant sources. It possesses antioxidant, anti-inflammatory, and potential anticancer properties. Pomolic acid has been studied for its role in cell signaling pathways and therapeutic effects on various diseases. Further research is ongoing to explore its pharmacological applications.
Catalog Number | M059890 |
CAS Number | 13849-91-7 |
Molecular Formula | C30H48O4 |
Purity | ≥95% |
Target | Apoptosis |
Storage | Store at -20°C |
IUPAC Name | (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-1,10-dihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
InChI | InChI=1S/C30H48O4/c1-18-10-15-30(24(32)33)17-16-27(5)19(23(30)29(18,7)34)8-9-21-26(4)13-12-22(31)25(2,3)20(26)11-14-28(21,27)6/h8,18,20-23,31,34H,9-17H2,1-7H3,(H,32,33)/t18-,20+,21-,22+,23-,26+,27-,28-,29-,30+/m1/s1 |
InChIKey | ZZTYPLSBNNGEIS-OPAXANQDSA-N |
SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1(C)O)C)C(=O)O |