For research use only. Not for therapeutic Use.
Porphine(CAT: M071749) is a macrocyclic organic compound and the simplest member of the porphyrin family. It consists of four pyrrole units connected by methine bridges, forming a large, planar ring structure. Porphine is a key structural framework in many biologically important molecules, such as heme and chlorophyll, where it plays a central role in binding metal ions like iron and magnesium. These metal complexes are crucial for processes like oxygen transport in blood (hemoglobin) and photosynthesis in plants. In research, porphine and its derivatives are studied for their electronic, photophysical, and catalytic properties, making them important in materials science and medicinal chemistry.
| Catalog Number | M071749 |
| CAS Number | 101-60-0 |
| Molecular Formula | C20H14N4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 21,22-dihydroporphyrin |
| InChI | InChI=1S/C20H14N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-12,21-22H |
| InChIKey | JZRYQZJSTWVBBD-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=CC=C(N3)C=C4C=CC(=N4)C=C5C=CC(=N5)C=C1N2 |
