For research use only. Not for therapeutic Use.
Porphobilinogen (Cat.No:R046496) is a vital precursor in the biosynthesis of heme, a crucial component of hemoglobin, myoglobin, and various enzymes. Its condensation leads to the formation of porphyrins, which play a central role in oxygen transport and many enzymatic reactions in living organisms.
Catalog Number | R046496 |
CAS Number | 487-90-1 |
Synonyms | 5-(Aminomethyl)-4-(carboxymethyl)-1H-pyrrole-3-propanoic Acid; PBG; |
Molecular Formula | C10H14N2O4 |
Purity | 97% |
Documentation | |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 3-[5-(aminomethyl)-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid |
InChI | InChI=1S/C10H14N2O4/c11-4-8-7(3-10(15)16)6(5-12-8)1-2-9(13)14/h5,12H,1-4,11H2,(H,13,14)(H,15,16) |
InChIKey | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(N1)CN)CC(=O)O)CCC(=O)O |