For research use only. Not for therapeutic Use.
Potassium 5-methyl-2-thiophenetrifluoroborate(Cat No.:L006958), is an organoboron compound. It is utilized in organic synthesis as a versatile reagent, particularly in palladium-catalyzed cross-coupling reactions. This compound serves as a source of the 5-methyl-2-thiophenyl group, which can be transferred to various organic molecules under appropriate reaction conditions. These reactions are essential in the development of pharmaceuticals, agrochemicals, and advanced materials. The compound’s selective reactivity and stability make it valuable in the creation of complex organic structures, aiding research in medicinal chemistry, materials science, and other disciplines requiring tailored organic molecules.
CAS Number | 871231-40-2 |
Molecular Formula | C5H5BF3KS |
Purity | ≥95% |
IUPAC Name | potassium;trifluoro-(5-methylthiophen-2-yl)boranuide |
InChI | InChI=1S/C5H5BF3S.K/c1-4-2-3-5(10-4)6(7,8)9;/h2-3H,1H3;/q-1;+1 |
InChIKey | SLHDDEQSKNIZEL-UHFFFAOYSA-N |
SMILES | [B-](C1=CC=C(S1)C)(F)(F)F.[K+] |