For research use only. Not for therapeutic Use.
Potassium Diphenylphosphide (Cat.No:M088570) is a chemical compound used as a reagent in organic synthesis. It serves as a source of diphenylphosphide anion in various reactions, enabling the introduction of phosphorus-containing groups into organic molecules. This compound plays a crucial role in the preparation of organophosphorus compounds and is a valuable tool in research and industrial applications.
CAS Number | 15475-27-1 |
Molecular Formula | C12H10KP |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | potassium;diphenylphosphanide |
InChI | InChI=1S/C12H10P.K/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;/q-1;+1 |
InChIKey | FCLYZQXPJKJTDR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)[P-]C2=CC=CC=C2.[K+] |