For research use only. Not for therapeutic Use.
Potassium dithionate(Cat No.:M065870), also known as potassium hyposulfite or potassium metabisulfite, is a chemical compound with the formula K2S2O6. It is a white crystalline solid soluble in water, commonly used as a reducing agent, antioxidant, and preservative in various industries, including food processing, pharmaceuticals, and water treatment. Potassium dithionate helps prevent oxidation and microbial growth in food products, extending their shelf life. Additionally, it serves as a disinfectant and sanitizer in water treatment processes, effectively removing impurities and pathogens.
CAS Number | 13455-20-4 |
Molecular Formula | K2O6S2 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/2K.H2O6S2/c;;1-7(2,3)8(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
InChIKey | POXRUQZSBXFWGH-UHFFFAOYSA-L |
SMILES | [O-]S(=O)(=O)S(=O)(=O)[O-].[K+].[K+] |