For research use only. Not for therapeutic Use.
Potassium Glycerophosphate (Cat.No:M049990) is a salt of glycerophosphoric acid and potassium. It is commonly used in pharmaceuticals and dietary supplements for its potential to support muscle function and nerve transmission. Additionally, it finds application in the food industry as an acidity regulator and nutrient supplement.
CAS Number | 1319-69-3 |
Molecular Formula | C3H7K2O6P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dipotassium;2,3-dihydroxypropyl phosphate |
InChI | InChI=1S/C3H9O6P.2K/c4-1-3(5)2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);;/q;2*+1/p-2 |
InChIKey | CHFUHGDBYUITQJ-UHFFFAOYSA-L |
SMILES | C(C(COP(=O)([O-])[O-])O)O.[K+].[K+] |