For research use only. Not for therapeutic Use.
Potassium Glycolate(Cat No.:M120746)is an important chemical compound used in various industrial and pharmaceutical applications. As the potassium salt of glycolic acid, it is commonly employed as a buffering agent, emulsifier, and pH adjuster in formulations. Its unique properties make it valuable in the production of cosmetics, personal care products, and pharmaceuticals, where it helps stabilize formulations and enhance product performance. Potassium Glycolate is also utilized in the synthesis of other chemicals, contributing to the development of innovative solutions in multiple industries.
CAS Number | 1932-50-9 |
Molecular Formula | C2H3KO3 |
Purity | ≥95% |
IUPAC Name | potassium;2-hydroxyacetate |
InChI | InChI=1S/C2H4O3.K/c3-1-2(4)5;/h3H,1H2,(H,4,5);/q;+1/p-1 |
InChIKey | FIJPWGLOBMXXSF-UHFFFAOYSA-M |
SMILES | C(C(=O)[O-])O.[K+] |