For research use only. Not for therapeutic Use.
Potassium laurate(Cat No.:M122987) is the potassium salt of lauric acid, a saturated fatty acid found in coconut oil and palm kernel oil. It is commonly used in the cosmetic and personal care industries as a surfactant and emulsifier. Potassium laurate helps to stabilize emulsions, allowing water and oil-based ingredients to mix evenly. It is often found in cleansers, shampoos, and shaving creams, where it contributes to the products’ foaming and cleansing properties. Potassium laurate is generally considered safe for use in cosmetics, but like all surfactants, it can irritate some individuals, particularly those with sensitive skin.
CAS Number | 10124-65-9 |
Molecular Formula | C12H23KO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | potassium;dodecanoate |
InChI | InChI=1S/C12H24O2.K/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;/h2-11H2,1H3,(H,13,14);/q;+1/p-1 |
InChIKey | HIDKSOTTZRMUML-UHFFFAOYSA-M |
SMILES | CCCCCCCCCCCC(=O)[O-].[K+] |