For research use only. Not for therapeutic Use.
Potassium palmitate is the potassium salt of palmitic acid, a long-chain saturated fatty acid commonly found in animal fats and vegetable oils. It is primarily used as a surfactant and emulsifying agent in soaps, cosmetics, and personal care products. Potassium palmitate helps to break down oils and fats, allowing them to mix with water, making it a key ingredient in cleansing formulations. In addition to its use in hygiene products, it is also employed in industrial applications where emulsification or mild detergent action is required. As a naturally derived compound, it is valued for its effectiveness and relatively low environmental impact.
| Catalog Number | M010394 |
| CAS Number | 2624-31-9 |
| Molecular Formula | C16H31KO2 |
| Purity | ≥95% |
| IUPAC Name | potassium;hexadecanoate |
| InChI | InChI=1S/C16H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | MQOCIYICOGDBSG-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[K+] |
