For research use only. Not for therapeutic Use.
Potassium pentathionate sesquihydrate is a chemica. This salt is a member of the polythionates, characterized by containing a chain of sulfur atoms. It is used primarily in analytical chemistry for the preparation of solutions used in redox reactions due to its oxidizing properties. Additionally, its stability and reactive nature make it suitable for various laboratory experiments, particularly in studies related to sulfur chemistry and its environmental interactions.
CAS Number | 23371-63-3 |
Synonyms | Pentathionic acid, dipotassium salt, hydrate (2:3); Pentathionic acid, dipotassium salt, sesquihydrate |
Molecular Formula | K2O6S5 |
Purity | ≥95% |
Storage | Store at -80 ℃ |
InChI | InChI=1S/2K.H2O6S5/c;;1-10(2,3)8-7-9-11(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
InChIKey | LLXIIVZIHGJSGU-UHFFFAOYSA-L |
SMILES | [O-]S(=O)(=O)SSSS(=O)(=O)[O-].[K+].[K+] |