For research use only. Not for therapeutic Use.
Potassium phenylacetate is the potassium salt of phenylacetic acid, commonly used in biochemical and pharmaceutical research. It is involved in the metabolic breakdown of phenylalanine and is used in treatments for conditions such as hyperammonemia, particularly in urea cycle disorders. Potassium phenylacetate acts by binding to ammonia, facilitating its excretion from the body. Additionally, it is explored for its potential anticancer properties and is used as a precursor in organic synthesis for producing various chemical and pharmaceutical intermediates.
CAS Number | 13005-36-2 |
Molecular Formula | C8H7KO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | potassium;2-phenylacetate |
InChI | InChI=1S/C8H8O2.K/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
InChIKey | JFOZPCWVLIBFCH-UHFFFAOYSA-M |
SMILES | C1=CC=C(C=C1)CC(=O)[O-].[K+] |